C13H13ClN2 — CID 43148771
2-chloro-1-N-(4-methylphenyl)benzene-1,4-diamine (PubChem CID 43148771) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 2-chloro-1-N-(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 43148771 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-chloro-1-N-(4-methylphenyl)benzene-1,4-diamine |
| SMILES | Cc1ccc(Nc2ccc(N)cc2Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2/c1-9-2-5-11(6-3-9)16-13-7-4-10(15)8-12(13)14/h2-8,16H,15H2,1H3 |
| InChIKey | FJYJUJAUDBGXJH-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|