C13H17Cl2N3 — CID 70626485
2-N-(4-aminophenyl)-4-methylbenzene-1,2-diamine;dihydrochloride (PubChem CID 70626485) has the molecular formula C13H17Cl2N3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2-N-(4-aminophenyl)-4-methylbenzene-1,2-diamine;dihydrochloride.
| Compound Name | 2-N-(4-aminophenyl)-4-methylbenzene-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 70626485 |
| Molecular Formula | C13H17Cl2N3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-N-(4-aminophenyl)-4-methylbenzene-1,2-diamine;dihydrochloride |
| SMILES | Cc1ccc(N)c(Nc2ccc(N)cc2)c1.Cl.Cl |
| InChI | InChI=1S/C13H15N3.2ClH/c1-9-2-7-12(15)13(8-9)16-11-5-3-10(14)4-6-11;;/h2-8,16H,14-15H2,1H3;2*1H |
| InChIKey | CERRDARWEMTGIP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|