C15H15N3O — CID 115126207
5-(2-amino-5-methylanilino)-1,3-dihydroindol-2-one (PubChem CID 115126207) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 5-(2-amino-5-methylanilino)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-amino-5-methylanilino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115126207 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 5-(2-amino-5-methylanilino)-1,3-dihydroindol-2-one |
| SMILES | Cc1ccc(N)c(Nc2ccc3c(c2)CC(=O)N3)c1 |
| InChI | InChI=1S/C15H15N3O/c1-9-2-4-12(16)14(6-9)17-11-3-5-13-10(7-11)8-15(19)18-13/h2-7,17H,8,16H2,1H3,(H,18,19) |
| InChIKey | GYLUFYSZARYECV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|