C15H15N3O — CID 115126233
4-methyl-2-N-(2-methyl-1,3-benzoxazol-6-yl)benzene-1,2-diamine (PubChem CID 115126233) has the molecular formula C15H15N3O and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-methyl-2-N-(2-methyl-1,3-benzoxazol-6-yl)benzene-1,2-diamine.
| Compound Name | 4-methyl-2-N-(2-methyl-1,3-benzoxazol-6-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 115126233 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 4-methyl-2-N-(2-methyl-1,3-benzoxazol-6-yl)benzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(Nc2ccc3nc(C)oc3c2)c1 |
| InChI | InChI=1S/C15H15N3O/c1-9-3-5-12(16)14(7-9)18-11-4-6-13-15(8-11)19-10(2)17-13/h3-8,18H,16H2,1-2H3 |
| InChIKey | QKJJTMUGFCKKSU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|