C27H26Cl2N4 — CID 90006139
1-N-[4-[3-[4-(4-amino-2-chloroanilino)phenyl]propyl]phenyl]-2-chlorobenzene-1,4-diamine (PubChem CID 90006139) has the molecular formula C27H26Cl2N4 and a molecular weight of 477.44 g/mol. Its IUPAC name is 1-N-[4-[3-[4-(4-amino-2-chloroanilino)phenyl]propyl]phenyl]-2-chlorobenzene-1,4-diamine.
| Compound Name | 1-N-[4-[3-[4-(4-amino-2-chloroanilino)phenyl]propyl]phenyl]-2-chlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 90006139 |
| Molecular Formula | C27H26Cl2N4 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-N-[4-[3-[4-(4-amino-2-chloroanilino)phenyl]propyl]phenyl]-2-chlorobenzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2ccc(CCCc3ccc(Nc4ccc(N)cc4Cl)cc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C27H26Cl2N4/c28-24-16-20(30)8-14-26(24)32-22-10-4-18(5-11-22)2-1-3-19-6-12-23(13-7-19)33-27-15-9-21(31)17-25(27)29/h4-17,32-33H,1-3,30-31H2 |
| InChIKey | SZDGSJZVZTUSCM-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|