C12H9Br2ClN2 — CID 107596513
2-chloro-1-N-(2,6-dibromophenyl)benzene-1,4-diamine (PubChem CID 107596513) has the molecular formula C12H9Br2ClN2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 2-chloro-1-N-(2,6-dibromophenyl)benzene-1,4-diamine.
| Compound Name | 2-chloro-1-N-(2,6-dibromophenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 107596513 |
| Molecular Formula | C12H9Br2ClN2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 2-chloro-1-N-(2,6-dibromophenyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(Nc2c(Br)cccc2Br)c(Cl)c1 |
| InChI | InChI=1S/C12H9Br2ClN2/c13-8-2-1-3-9(14)12(8)17-11-5-4-7(16)6-10(11)15/h1-6,17H,16H2 |
| InChIKey | MAKYGWBQYQBLMT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|