C12H7Br4N — CID 101290135
2,6-dibromo-N-(2,4-dibromophenyl)aniline (PubChem CID 101290135) has the molecular formula C12H7Br4N and a molecular weight of 484.81 g/mol. Its IUPAC name is 2,6-dibromo-N-(2,4-dibromophenyl)aniline.
| Compound Name | 2,6-dibromo-N-(2,4-dibromophenyl)aniline |
|---|---|
| PubChem CID | 101290135 |
| Molecular Formula | C12H7Br4N |
| Molecular Weight | 484.81 g/mol |
| Exact Mass | 480.73 |
| IUPAC Name | 2,6-dibromo-N-(2,4-dibromophenyl)aniline |
| SMILES | Brc1ccc(Nc2c(Br)cccc2Br)c(Br)c1 |
| InChI | InChI=1S/C12H7Br4N/c13-7-4-5-11(10(16)6-7)17-12-8(14)2-1-3-9(12)15/h1-6,17H |
| InChIKey | NUFRUEYJKRWVLT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.81 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |