C12H11Br2N3 — CID 80801057
6-N-(2,4-dibromophenyl)-2-N-methylpyridine-2,6-diamine (PubChem CID 80801057) has the molecular formula C12H11Br2N3 and a molecular weight of 357.05 g/mol. Its IUPAC name is 6-N-(2,4-dibromophenyl)-2-N-methylpyridine-2,6-diamine.
| Compound Name | 6-N-(2,4-dibromophenyl)-2-N-methylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80801057 |
| Molecular Formula | C12H11Br2N3 |
| Molecular Weight | 357.05 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | 6-N-(2,4-dibromophenyl)-2-N-methylpyridine-2,6-diamine |
| SMILES | CNc1cccc(Nc2ccc(Br)cc2Br)n1 |
| InChI | InChI=1S/C12H11Br2N3/c1-15-11-3-2-4-12(17-11)16-10-6-5-8(13)7-9(10)14/h2-7H,1H3,(H2,15,16,17) |
| InChIKey | URKXJBSFTNLJKX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.05 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |