C15H12ClN3 — CID 61340093
4-chloro-3-N-quinolin-4-ylbenzene-1,3-diamine (PubChem CID 61340093) has the molecular formula C15H12ClN3 and a molecular weight of 269.74 g/mol. Its IUPAC name is 4-chloro-3-N-quinolin-4-ylbenzene-1,3-diamine.
| Compound Name | 4-chloro-3-N-quinolin-4-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 61340093 |
| Molecular Formula | C15H12ClN3 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-chloro-3-N-quinolin-4-ylbenzene-1,3-diamine |
| SMILES | Nc1ccc(Cl)c(Nc2ccnc3ccccc23)c1 |
| InChI | InChI=1S/C15H12ClN3/c16-12-6-5-10(17)9-15(12)19-14-7-8-18-13-4-2-1-3-11(13)14/h1-9H,17H2,(H,18,19) |
| InChIKey | SOINCQWMSFPQSH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|