C17H14ClFN2O2 — CID 24999709
N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinolin-4-amine (PubChem CID 24999709) has the molecular formula C17H14ClFN2O2 and a molecular weight of 332.76 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinolin-4-amine |
|---|---|
| PubChem CID | 24999709 |
| Molecular Formula | C17H14ClFN2O2 |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-6,7-dimethoxyquinolin-4-amine |
| SMILES | COc1cc2nccc(Nc3ccc(F)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C17H14ClFN2O2/c1-22-16-8-11-14(5-6-20-15(11)9-17(16)23-2)21-10-3-4-13(19)12(18)7-10/h3-9H,1-2H3,(H,20,21) |
| InChIKey | ZJTXHUYOAFMZOW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |