C21H24ClFN6O2 — CID 175042827
1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[2-(dimethylamino)ethylamino]urea (PubChem CID 175042827) has the molecular formula C21H24ClFN6O2 and a molecular weight of 446.91 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[2-(dimethylamino)ethylamino]urea.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[2-(dimethylamino)ethylamino]urea |
|---|---|
| PubChem CID | 175042827 |
| Molecular Formula | C21H24ClFN6O2 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[2-(dimethylamino)ethylamino]urea |
| SMILES | COc1cc2nccc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)NNCCN(C)C |
| InChI | InChI=1S/C21H24ClFN6O2/c1-29(2)9-8-25-28-21(30)27-19-11-14-17(6-7-24-18(14)12-20(19)31-3)26-13-4-5-16(23)15(22)10-13/h4-7,10-12,25H,8-9H2,1-3H3,(H,24,26)(H2,27,28,30) |
| InChIKey | MOTHIZHNYKMROP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|