C24H19ClFN5O3 — CID 141482444
1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(4-hydroxyphenyl)methylideneamino]urea (PubChem CID 141482444) has the molecular formula C24H19ClFN5O3 and a molecular weight of 479.90 g/mol. Its IUPAC name is 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(4-hydroxyphenyl)methylideneamino]urea.
| Compound Name | 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(4-hydroxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 141482444 |
| Molecular Formula | C24H19ClFN5O3 |
| Molecular Weight | 479.90 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinolin-6-yl]-3-[(E)-(4-hydroxyphenyl)methylideneamino]urea |
| SMILES | COc1cc2nccc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)N/N=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C24H19ClFN5O3/c1-34-23-12-21-17(20(8-9-27-21)29-15-4-7-19(26)18(25)10-15)11-22(23)30-24(33)31-28-13-14-2-5-16(32)6-3-14/h2-13,32H,1H3,(H,27,29)(H2,30,31,33)/b28-13+ |
| InChIKey | TZWQBYRTIYBEGQ-XODNFHPESA-N |
| XLogP | 5.64 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|