C23H24ClF2N5O2 — CID 140723094
N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(diethylamino)-2-fluorobut-2-enamide (PubChem CID 140723094) has the molecular formula C23H24ClF2N5O2 and a molecular weight of 475.93 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(diethylamino)-2-fluorobut-2-enamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(diethylamino)-2-fluorobut-2-enamide |
|---|---|
| PubChem CID | 140723094 |
| Molecular Formula | C23H24ClF2N5O2 |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(diethylamino)-2-fluorobut-2-enamide |
| SMILES | CCN(CC)CC=C(F)C(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC |
| InChI | InChI=1S/C23H24ClF2N5O2/c1-4-31(5-2)9-8-18(26)23(32)30-20-11-15-19(12-21(20)33-3)27-13-28-22(15)29-14-6-7-17(25)16(24)10-14/h6-8,10-13H,4-5,9H2,1-3H3,(H,30,32)(H,27,28,29) |
| InChIKey | VDIWQTVAHKHSCA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|