C21H20BrF2N5O2 — CID 71244667
N-[4-(4-bromo-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide (PubChem CID 71244667) has the molecular formula C21H20BrF2N5O2 and a molecular weight of 492.32 g/mol. Its IUPAC name is N-[4-(4-bromo-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide.
| Compound Name | N-[4-(4-bromo-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide |
|---|---|
| PubChem CID | 71244667 |
| Molecular Formula | C21H20BrF2N5O2 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-[4-(4-bromo-2-fluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide |
| SMILES | COc1cc2ncnc(Nc3ccc(Br)cc3F)c2cc1NC(=O)C(F)=CCN(C)C |
| InChI | InChI=1S/C21H20BrF2N5O2/c1-29(2)7-6-14(23)21(30)28-18-9-13-17(10-19(18)31-3)25-11-26-20(13)27-16-5-4-12(22)8-15(16)24/h4-6,8-11H,7H2,1-3H3,(H,28,30)(H,25,26,27) |
| InChIKey | QCEVSAJBJUEMAG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|