C21H19ClF3N5O2 — CID 71512474
(Z)-N-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide (PubChem CID 71512474) has the molecular formula C21H19ClF3N5O2 and a molecular weight of 465.86 g/mol. Its IUPAC name is (Z)-N-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide.
| Compound Name | (Z)-N-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide |
|---|---|
| PubChem CID | 71512474 |
| Molecular Formula | C21H19ClF3N5O2 |
| Molecular Weight | 465.86 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (Z)-N-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]-4-(dimethylamino)-2-fluorobut-2-enamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3F)c2cc1NC(=O)/C(F)=C/CN(C)C |
| InChI | InChI=1S/C21H19ClF3N5O2/c1-30(2)7-6-13(24)21(31)29-16-8-11-15(9-17(16)32-3)26-10-27-20(11)28-14-5-4-12(23)18(22)19(14)25/h4-6,8-10H,7H2,1-3H3,(H,29,31)(H,26,27,28)/b13-6- |
| InChIKey | CVCDGRYADHIKQL-MLPAPPSSSA-N |
| XLogP | 4.67 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|