C21H20ClF2N5O3 — CID 142760923
4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxamide (PubChem CID 142760923) has the molecular formula C21H20ClF2N5O3 and a molecular weight of 463.87 g/mol. Its IUPAC name is 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxamide.
| Compound Name | 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 142760923 |
| Molecular Formula | C21H20ClF2N5O3 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3F)c2cc1OC1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C21H20ClF2N5O3/c1-31-16-9-15-12(8-17(16)32-11-4-6-29(7-5-11)21(25)30)20(27-10-26-15)28-14-3-2-13(23)18(22)19(14)24/h2-3,8-11H,4-7H2,1H3,(H2,25,30)(H,26,27,28) |
| InChIKey | SHEAFHRPOYJSRI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|