C28H32ClF2N5O4 — CID 11421816
2-piperidin-1-ylethyl 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxylate (PubChem CID 11421816) has the molecular formula C28H32ClF2N5O4 and a molecular weight of 576.04 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxylate.
| Compound Name | 2-piperidin-1-ylethyl 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11421816 |
| Molecular Formula | C28H32ClF2N5O4 |
| Molecular Weight | 576.04 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 2-piperidin-1-ylethyl 4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidine-1-carboxylate |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3F)c2cc1OC1CCN(C(=O)OCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C28H32ClF2N5O4/c1-38-23-16-22-19(27(33-17-32-22)34-21-6-5-20(30)25(29)26(21)31)15-24(23)40-18-7-11-36(12-8-18)28(37)39-14-13-35-9-3-2-4-10-35/h5-6,15-18H,2-4,7-14H2,1H3,(H,32,33,34) |
| InChIKey | MGTBTQYQBPWHRY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.04 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|