C26H29ClF2N4O4 — CID 69229794
2-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3,3-dimethylbutanoic acid (PubChem CID 69229794) has the molecular formula C26H29ClF2N4O4 and a molecular weight of 534.99 g/mol. Its IUPAC name is 2-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 2-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 69229794 |
| Molecular Formula | C26H29ClF2N4O4 |
| Molecular Weight | 534.99 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2-[4-[4-(3-chloro-2,4-difluoroanilino)-7-methoxyquinazolin-6-yl]oxypiperidin-1-yl]-3,3-dimethylbutanoic acid |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3F)c2cc1OC1CCN(C(C(=O)O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C26H29ClF2N4O4/c1-26(2,3)23(25(34)35)33-9-7-14(8-10-33)37-20-11-15-18(12-19(20)36-4)30-13-31-24(15)32-17-6-5-16(28)21(27)22(17)29/h5-6,11-14,23H,7-10H2,1-4H3,(H,34,35)(H,30,31,32) |
| InChIKey | CZVSLFWITSFROO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.99 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|