C22H21ClF2N4O2 — CID 174819906
6-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]oxy]-N-(3-chloro-2,4-difluorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 174819906) has the molecular formula C22H21ClF2N4O2 and a molecular weight of 446.89 g/mol. Its IUPAC name is 6-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]oxy]-N-(3-chloro-2,4-difluorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]oxy]-N-(3-chloro-2,4-difluorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 174819906 |
| Molecular Formula | C22H21ClF2N4O2 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 6-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]oxy]-N-(3-chloro-2,4-difluorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3F)c2cc1OC1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C22H21ClF2N4O2/c1-30-18-7-17-14(6-19(18)31-13-4-11-8-26-9-12(11)5-13)22(28-10-27-17)29-16-3-2-15(24)20(23)21(16)25/h2-3,6-7,10-13,26H,4-5,8-9H2,1H3,(H,27,28,29)/t11-,12+,13? |
| InChIKey | SENQDJWAJJVLIO-FUNVUKJBSA-N |
| XLogP | 4.69 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|