C24H26ClFN4O2 — CID 118457220
7-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-chloro-2-fluoro-3-methylphenyl)-6-methoxyquinazolin-4-amine (PubChem CID 118457220) has the molecular formula C24H26ClFN4O2 and a molecular weight of 456.95 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-chloro-2-fluoro-3-methylphenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-chloro-2-fluoro-3-methylphenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 118457220 |
| Molecular Formula | C24H26ClFN4O2 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 7-[[(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-chloro-2-fluoro-3-methylphenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(C)c3F)ncnc2cc1OCC1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C24H26ClFN4O2/c1-13-18(25)3-4-19(23(13)26)30-24-17-7-21(31-2)22(8-20(17)28-12-29-24)32-11-14-5-15-9-27-10-16(15)6-14/h3-4,7-8,12,14-16,27H,5-6,9-11H2,1-2H3,(H,28,29,30)/t14?,15-,16+ |
| InChIKey | WANIJWLDWOXKCK-MQVJKMGUSA-N |
| XLogP | 5.11 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |