C24H26Cl2N4O2 — CID 10073562
7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 10073562) has the molecular formula C24H26Cl2N4O2 and a molecular weight of 473.40 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 10073562 |
| Molecular Formula | C24H26Cl2N4O2 |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCC1C[C@@H]2CN(C)C[C@@H]2C1 |
| InChI | InChI=1S/C24H26Cl2N4O2/c1-30-10-15-5-14(6-16(15)11-30)12-32-23-9-21-18(8-22(23)31-2)24(28-13-27-21)29-17-3-4-19(25)20(26)7-17/h3-4,7-9,13-16H,5-6,10-12H2,1-2H3,(H,27,28,29)/t14?,15-,16+ |
| InChIKey | XJAYAHAZZKYCJC-MQVJKMGUSA-N |
| XLogP | 5.66 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |