C24H26BrCl2FN4O2 — CID 66838595
7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride (PubChem CID 66838595) has the molecular formula C24H26BrCl2FN4O2 and a molecular weight of 572.31 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride.
| Compound Name | 7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 66838595 |
| Molecular Formula | C24H26BrCl2FN4O2 |
| Molecular Weight | 572.31 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | 7-[[(3aS,6aR)-2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]methoxy]-N-(4-bromo-5-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine;hydrochloride |
| SMILES | COc1cc2c(Nc3cc(Cl)c(Br)cc3F)ncnc2cc1OCC1C[C@@H]2CN(C)C[C@@H]2C1.Cl |
| InChI | InChI=1S/C24H25BrClFN4O2.ClH/c1-31-9-14-3-13(4-15(14)10-31)11-33-23-8-20-16(5-22(23)32-2)24(29-12-28-20)30-21-7-18(26)17(25)6-19(21)27;/h5-8,12-15H,3-4,9-11H2,1-2H3,(H,28,29,30);1H/t13?,14-,15+; |
| InChIKey | FAESCTSAVSFLJV-XZPOUAKSSA-N |
| XLogP | 6.33 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.31 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|