C23H22Cl2FN3O5 — CID 66954904
7-[[(3S,3aR,6S,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 66954904) has the molecular formula C23H22Cl2FN3O5 and a molecular weight of 510.35 g/mol. Its IUPAC name is 7-[[(3S,3aR,6S,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3S,3aR,6S,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 66954904 |
| Molecular Formula | C23H22Cl2FN3O5 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | 7-[[(3S,3aR,6S,6aS)-6-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(Cl)c(Cl)cc3F)ncnc2cc1OC[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2OC |
| InChI | InChI=1S/C23H22Cl2FN3O5/c1-30-18-3-12-16(27-10-28-23(12)29-17-5-14(25)13(24)4-15(17)26)6-19(18)32-7-11-8-33-22-20(31-2)9-34-21(11)22/h3-6,10-11,20-22H,7-9H2,1-2H3,(H,27,28,29)/t11-,20+,21-,22-/m1/s1 |
| InChIKey | KTBQYTJFMLOVMP-VNTFJFIFSA-N |
| XLogP | 4.64 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|