C23H22BClFN3O5 — CID 89260984
CID 89260984 (PubChem CID 89260984) has the molecular formula C23H22BClFN3O5 and a molecular weight of 485.71 g/mol.
| Compound Name | CID 89260984 |
|---|---|
| PubChem CID | 89260984 |
| Molecular Formula | C23H22BClFN3O5 |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)c(Nc2ncnc3cc(OCC4CO[C@@H]5[C@@H](OC)CO[C@H]45)c(OC)cc23)cc1Cl |
| InChI | InChI=1S/C23H22BClFN3O5/c1-30-18-3-12-16(27-10-28-23(12)29-17-5-14(25)13(24)4-15(17)26)6-19(18)32-7-11-8-33-22-20(31-2)9-34-21(11)22/h3-6,10-11,20-22H,7-9H2,1-2H3,(H,27,28,29)/t11?,20-,21+,22+/m0/s1 |
| InChIKey | LZDPVTYECVZSDT-QOPSNYKOSA-N |
| XLogP | 2.78 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|