C23H23Cl2FN4O4 — CID 77211319
7-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-1-ylmethoxy)-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 77211319) has the molecular formula C23H23Cl2FN4O4 and a molecular weight of 509.37 g/mol. Its IUPAC name is 7-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-1-ylmethoxy)-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-1-ylmethoxy)-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 77211319 |
| Molecular Formula | C23H23Cl2FN4O4 |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 7-(3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-1-ylmethoxy)-N-(4,5-dichloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(Cl)c(Cl)cc3F)ncnc2cc1OCC1OCCN2CCOCC12 |
| InChI | InChI=1S/C23H23Cl2FN4O4/c1-31-20-6-13-17(27-12-28-23(13)29-18-8-15(25)14(24)7-16(18)26)9-21(20)34-11-22-19-10-32-4-2-30(19)3-5-33-22/h6-9,12,19,22H,2-5,10-11H2,1H3,(H,27,28,29) |
| InChIKey | SQMPEPDQJYJKDT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|