C25H30ClFN4O4 — CID 142852302
7-[[(3R,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine;fluoromethane (PubChem CID 142852302) has the molecular formula C25H30ClFN4O4 and a molecular weight of 504.99 g/mol. Its IUPAC name is 7-[[(3R,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine;fluoromethane.
| Compound Name | 7-[[(3R,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine;fluoromethane |
|---|---|
| PubChem CID | 142852302 |
| Molecular Formula | C25H30ClFN4O4 |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 7-[[(3R,9aS)-3,4,6,7,9,9a-hexahydro-1H-[1,4]oxazino[3,4-c][1,4]oxazin-3-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine;fluoromethane |
| SMILES | CF.COc1cc2c(Nc3ccc(Cl)c(C)c3)ncnc2cc1OC[C@H]1CN2CCOC[C@H]2CO1 |
| InChI | InChI=1S/C24H27ClN4O4.CH3F/c1-15-7-16(3-4-20(15)25)28-24-19-8-22(30-2)23(9-21(19)26-14-27-24)33-13-18-10-29-5-6-31-11-17(29)12-32-18;1-2/h3-4,7-9,14,17-18H,5-6,10-13H2,1-2H3,(H,26,27,28);1H3/t17-,18+;/m0./s1 |
| InChIKey | NGFGOKDZTFWQBH-CJRXIRLBSA-N |
| XLogP | 4.41 |
| TPSA | 77.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |