C23H25ClN4O3S — CID 58013770
7-[[(8aR)-1,3,5,6,8,8a-hexahydro-[1,3]thiazolo[4,3-c][1,4]oxazin-6-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine (PubChem CID 58013770) has the molecular formula C23H25ClN4O3S and a molecular weight of 473.00 g/mol. Its IUPAC name is 7-[[(8aR)-1,3,5,6,8,8a-hexahydro-[1,3]thiazolo[4,3-c][1,4]oxazin-6-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(8aR)-1,3,5,6,8,8a-hexahydro-[1,3]thiazolo[4,3-c][1,4]oxazin-6-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 58013770 |
| Molecular Formula | C23H25ClN4O3S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 7-[[(8aR)-1,3,5,6,8,8a-hexahydro-[1,3]thiazolo[4,3-c][1,4]oxazin-6-yl]methoxy]-N-(4-chloro-3-methylphenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(C)c3)ncnc2cc1OCC1CN2CSC[C@H]2CO1 |
| InChI | InChI=1S/C23H25ClN4O3S/c1-14-5-15(3-4-19(14)24)27-23-18-6-21(29-2)22(7-20(18)25-12-26-23)31-10-17-8-28-13-32-11-16(28)9-30-17/h3-7,12,16-17H,8-11,13H2,1-2H3,(H,25,26,27)/t16-,17?/m1/s1 |
| InChIKey | ZXFQTDKILPRJDQ-TZHYSIJRSA-N |
| XLogP | 4.50 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |