C23H25Cl2N7O3 — CID 163576178
7-[[4-[diazo(ethylamino)methyl]morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 163576178) has the molecular formula C23H25Cl2N7O3 and a molecular weight of 518.41 g/mol. Its IUPAC name is 7-[[4-[diazo(ethylamino)methyl]morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[4-[diazo(ethylamino)methyl]morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 163576178 |
| Molecular Formula | C23H25Cl2N7O3 |
| Molecular Weight | 518.41 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 7-[[4-[diazo(ethylamino)methyl]morpholin-2-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | CCNC(=[N+]=[N-])N1CCOC(COc2cc3ncnc(Nc4ccc(Cl)c(Cl)c4)c3cc2OC)C1 |
| InChI | InChI=1S/C23H25Cl2N7O3/c1-3-27-23(31-26)32-6-7-34-15(11-32)12-35-21-10-19-16(9-20(21)33-2)22(29-13-28-19)30-14-4-5-17(24)18(25)8-14/h4-5,8-10,13,15,27H,3,6-7,11-12H2,1-2H3,(H,28,29,30) |
| InChIKey | GDQNTZJAMSCNFJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|