C29H28Cl2IN4O4- — CID 142852608
CID 142852608 (PubChem CID 142852608) has the molecular formula C29H28Cl2IN4O4- and a molecular weight of 694.38 g/mol.
| Compound Name | CID 142852608 |
|---|---|
| PubChem CID | 142852608 |
| Molecular Formula | C29H28Cl2IN4O4- |
| Molecular Weight | 694.38 g/mol |
| Exact Mass | 693.05 |
| IUPAC Name | — |
| SMILES | CCC(C(=O)N1CC(COc2cc3ncnc(Nc4ccc(Cl)c(Cl)c4)c3cc2OC)OC[I-]1)c1ccccc1 |
| InChI | InChI=1S/C29H28Cl2IN4O4/c1-3-21(18-7-5-4-6-8-18)29(37)36-14-20(40-16-32-36)15-39-27-13-25-22(12-26(27)38-2)28(34-17-33-25)35-19-9-10-23(30)24(31)11-19/h4-13,17,20-21H,3,14-16H2,1-2H3,(H,33,34,35)/q-1 |
| InChIKey | KPOSGVPPBAFFRU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|