C24H25Cl2N3O5 — CID 66838511
7-[[(3S,3aR,6S,6aS)-6-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 66838511) has the molecular formula C24H25Cl2N3O5 and a molecular weight of 506.39 g/mol. Its IUPAC name is 7-[[(3S,3aR,6S,6aS)-6-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3S,3aR,6S,6aS)-6-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 66838511 |
| Molecular Formula | C24H25Cl2N3O5 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 7-[[(3S,3aR,6S,6aS)-6-ethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]methoxy]-N-(3,4-dichlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | CCO[C@H]1CO[C@@H]2[C@H](COc3cc4ncnc(Nc5ccc(Cl)c(Cl)c5)c4cc3OC)CO[C@@H]21 |
| InChI | InChI=1S/C24H25Cl2N3O5/c1-3-31-21-11-34-22-13(10-33-23(21)22)9-32-20-8-18-15(7-19(20)30-2)24(28-12-27-18)29-14-4-5-16(25)17(26)6-14/h4-8,12-13,21-23H,3,9-11H2,1-2H3,(H,27,28,29)/t13-,21+,22-,23-/m1/s1 |
| InChIKey | KFTRSFMLHMBJMH-VHQKCTGVSA-N |
| XLogP | 4.89 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |