C21H20BrClN4O4 — CID 71085597
7-[[(3R,6R)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 71085597) has the molecular formula C21H20BrClN4O4 and a molecular weight of 507.77 g/mol. Its IUPAC name is 7-[[(3R,6R)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3R,6R)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 71085597 |
| Molecular Formula | C21H20BrClN4O4 |
| Molecular Weight | 507.77 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | 7-[[(3R,6R)-3-amino-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)c(Cl)c3)ncnc2cc1O[C@@H]1COC2C1OC[C@H]2N |
| InChI | InChI=1S/C21H20BrClN4O4/c1-28-16-5-11-15(6-17(16)31-18-8-30-19-14(24)7-29-20(18)19)25-9-26-21(11)27-10-2-3-12(22)13(23)4-10/h2-6,9,14,18-20H,7-8,24H2,1H3,(H,25,26,27)/t14-,18-,19?,20?/m1/s1 |
| InChIKey | KTJGGFYHAOWIMA-HPJZBDCMSA-N |
| XLogP | 3.67 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |