C21H18BrF2N3O4 — CID 66838574
7-[[(3R,3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(2-bromo-4-fluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 66838574) has the molecular formula C21H18BrF2N3O4 and a molecular weight of 494.29 g/mol. Its IUPAC name is 7-[[(3R,3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(2-bromo-4-fluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3R,3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(2-bromo-4-fluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 66838574 |
| Molecular Formula | C21H18BrF2N3O4 |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 7-[[(3R,3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(2-bromo-4-fluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(F)cc3Br)ncnc2cc1O[C@@H]1CO[C@@H]2[C@H]1OC[C@H]2F |
| InChI | InChI=1S/C21H18BrF2N3O4/c1-28-16-5-11-15(6-17(16)31-18-8-30-19-13(24)7-29-20(18)19)25-9-26-21(11)27-14-3-2-10(23)4-12(14)22/h2-6,9,13,18-20H,7-8H2,1H3,(H,25,26,27)/t13-,18-,19+,20+/m1/s1 |
| InChIKey | IVTMGIFJCKLZRO-YFMMTPMMSA-N |
| XLogP | 4.17 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |