C26H30FN5O4 — CID 58013797
7-[[(3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine (PubChem CID 58013797) has the molecular formula C26H30FN5O4 and a molecular weight of 495.56 g/mol. Its IUPAC name is 7-[[(3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine.
| Compound Name | 7-[[(3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 58013797 |
| Molecular Formula | C26H30FN5O4 |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 7-[[(3aS,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-6-methoxy-N-[4-(4-methylpiperazin-1-yl)phenyl]quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(N4CCN(C)CC4)cc3)ncnc2cc1OC1CO[C@H]2[C@H](F)CO[C@@H]12 |
| InChI | InChI=1S/C26H30FN5O4/c1-31-7-9-32(10-8-31)17-5-3-16(4-6-17)30-26-18-11-21(33-2)22(12-20(18)28-15-29-26)36-23-14-35-24-19(27)13-34-25(23)24/h3-6,11-12,15,19,23-25H,7-10,13-14H2,1-2H3,(H,28,29,30)/t19-,23?,24+,25+/m1/s1 |
| InChIKey | URCDTLIXDIHXQP-BKHNRWHUSA-N |
| XLogP | 3.02 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|