C26H28Cl2FN5O4 — CID 67161450
7-[[(3S,3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[3,4-dichloro-2-(4-methylpiperazin-1-yl)phenyl]-6-methoxyquinazolin-4-amine (PubChem CID 67161450) has the molecular formula C26H28Cl2FN5O4 and a molecular weight of 564.45 g/mol. Its IUPAC name is 7-[[(3S,3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[3,4-dichloro-2-(4-methylpiperazin-1-yl)phenyl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3S,3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[3,4-dichloro-2-(4-methylpiperazin-1-yl)phenyl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 67161450 |
| Molecular Formula | C26H28Cl2FN5O4 |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 7-[[(3S,3aR,6S,6aS)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[3,4-dichloro-2-(4-methylpiperazin-1-yl)phenyl]-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3N3CCN(C)CC3)ncnc2cc1O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2F |
| InChI | InChI=1S/C26H28Cl2FN5O4/c1-33-5-7-34(8-6-33)23-17(4-3-15(27)22(23)28)32-26-14-9-19(35-2)20(10-18(14)30-13-31-26)38-21-12-37-24-16(29)11-36-25(21)24/h3-4,9-10,13,16,21,24-25H,5-8,11-12H2,1-2H3,(H,30,31,32)/t16-,21-,24+,25+/m0/s1 |
| InChIKey | UIBFVYOIDXCKPI-YPWPWMHZSA-N |
| XLogP | 4.32 |
| TPSA | 81.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |