C22H18BrF4N3O4 — CID 58616995
7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[2-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine (PubChem CID 58616995) has the molecular formula C22H18BrF4N3O4 and a molecular weight of 544.30 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[2-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[2-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 58616995 |
| Molecular Formula | C22H18BrF4N3O4 |
| Molecular Weight | 544.30 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[2-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(C(F)(F)F)ccc3Br)ncnc2cc1OC1CO[C@H]2C(F)CO[C@@H]12 |
| InChI | InChI=1S/C22H18BrF4N3O4/c1-31-16-5-11-14(6-17(16)34-18-8-33-19-13(24)7-32-20(18)19)28-9-29-21(11)30-15-4-10(22(25,26)27)2-3-12(15)23/h2-6,9,13,18-20H,7-8H2,1H3,(H,28,29,30)/t13?,18?,19-,20-/m0/s1 |
| InChIKey | IXLSYYGZAKKXCH-SCWZEAEOSA-N |
| XLogP | 5.05 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |