C22H19BrF3N3O4 — CID 70801506
7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[3-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine (PubChem CID 70801506) has the molecular formula C22H19BrF3N3O4 and a molecular weight of 526.31 g/mol. Its IUPAC name is 7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[3-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[3-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 70801506 |
| Molecular Formula | C22H19BrF3N3O4 |
| Molecular Weight | 526.31 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | 7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[3-bromo-5-(trifluoromethyl)phenyl]-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(Br)cc(C(F)(F)F)c3)ncnc2cc1O[C@@H]1COC2CCOC21 |
| InChI | InChI=1S/C22H19BrF3N3O4/c1-30-17-7-14-15(8-18(17)33-19-9-32-16-2-3-31-20(16)19)27-10-28-21(14)29-13-5-11(22(24,25)26)4-12(23)6-13/h4-8,10,16,19-20H,2-3,9H2,1H3,(H,27,28,29)/t16?,19-,20?/m1/s1 |
| InChIKey | AJUHOTOMABHDAI-NQKNOSNGSA-N |
| XLogP | 5.10 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.31 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |