C23H23F4N3O4 — CID 162558478
7-[[(6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[4-fluoro-3-methyl-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-6-methoxyquinazolin-4-amine (PubChem CID 162558478) has the molecular formula C23H23F4N3O4 and a molecular weight of 481.45 g/mol. Its IUPAC name is 7-[[(6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[4-fluoro-3-methyl-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[4-fluoro-3-methyl-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 162558478 |
| Molecular Formula | C23H23F4N3O4 |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 7-[[(6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-[4-fluoro-3-methyl-3-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(NC3=CC(C)(C(F)(F)F)C(F)C=C3)ncnc2cc1O[C@@H]1COC2CCO[C@H]21 |
| InChI | InChI=1S/C23H23F4N3O4/c1-22(23(25,26)27)9-12(3-4-19(22)24)30-21-13-7-16(31-2)17(8-14(13)28-11-29-21)34-18-10-33-15-5-6-32-20(15)18/h3-4,7-9,11,15,18-20H,5-6,10H2,1-2H3,(H,28,29,30)/t15?,18-,19?,20-,22?/m1/s1 |
| InChIKey | NSEFMTVZKVGZMF-DHFPTZSFSA-N |
| XLogP | 4.35 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |