C22H21BrClN3O5 — CID 66838506
7-[[(3S,3aS,6R,6aS)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 66838506) has the molecular formula C22H21BrClN3O5 and a molecular weight of 522.78 g/mol. Its IUPAC name is 7-[[(3S,3aS,6R,6aS)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3S,3aS,6R,6aS)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 66838506 |
| Molecular Formula | C22H21BrClN3O5 |
| Molecular Weight | 522.78 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | 7-[[(3S,3aS,6R,6aS)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)c(Cl)c3)ncnc2cc1O[C@@H]1CO[C@@H]2[C@H]1OC[C@@H]2OC |
| InChI | InChI=1S/C22H21BrClN3O5/c1-28-16-6-12-15(25-10-26-22(12)27-11-3-4-13(23)14(24)5-11)7-17(16)32-19-9-31-20-18(29-2)8-30-21(19)20/h3-7,10,18-21H,8-9H2,1-2H3,(H,25,26,27)/t18-,19+,20-,21-/m0/s1 |
| InChIKey | OUEOJFCFMCXADD-WOZUAGRISA-N |
| XLogP | 4.36 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.78 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |