C23H23BrClN3O6 — CID 66838711
7-[[(3R,3aS,5R,6S,6aR)-5,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 66838711) has the molecular formula C23H23BrClN3O6 and a molecular weight of 552.81 g/mol. Its IUPAC name is 7-[[(3R,3aS,5R,6S,6aR)-5,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3R,3aS,5R,6S,6aR)-5,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 66838711 |
| Molecular Formula | C23H23BrClN3O6 |
| Molecular Weight | 552.81 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | 7-[[(3R,3aS,5R,6S,6aR)-5,6-dimethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)c(Cl)c3)ncnc2cc1O[C@@H]1CO[C@H]2[C@H](OC)[C@H](OC)O[C@H]21 |
| InChI | InChI=1S/C23H23BrClN3O6/c1-29-16-7-12-15(26-10-27-22(12)28-11-4-5-13(24)14(25)6-11)8-17(16)33-18-9-32-20-19(18)34-23(31-3)21(20)30-2/h4-8,10,18-21,23H,9H2,1-3H3,(H,26,27,28)/t18-,19+,20-,21+,23-/m1/s1 |
| InChIKey | NJKVUYJCCZCQNK-HVJVJISESA-N |
| XLogP | 4.33 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.81 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |