C27H21ClF3N3O5 — CID 58617041
7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]-6-methoxyquinazolin-4-amine (PubChem CID 58617041) has the molecular formula C27H21ClF3N3O5 and a molecular weight of 559.93 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 58617041 |
| Molecular Formula | C27H21ClF3N3O5 |
| Molecular Weight | 559.93 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-[4-(4-chlorophenoxy)-3,5-difluorophenyl]-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cc(F)c(Oc4ccc(Cl)cc4)c(F)c3)ncnc2cc1OC1CO[C@H]2C(F)CO[C@@H]12 |
| InChI | InChI=1S/C27H21ClF3N3O5/c1-35-21-8-16-20(9-22(21)39-23-11-37-25-19(31)10-36-26(23)25)32-12-33-27(16)34-14-6-17(29)24(18(30)7-14)38-15-4-2-13(28)3-5-15/h2-9,12,19,23,25-26H,10-11H2,1H3,(H,32,33,34)/t19?,23?,25-,26-/m0/s1 |
| InChIKey | XXVRAEWUOFARHO-PDYCKMPASA-N |
| XLogP | 5.99 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.93 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |