C22H22ClN3O6 — CID 126652403
(3S,3aR,6aR)-6-[2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 126652403) has the molecular formula C22H22ClN3O6 and a molecular weight of 459.89 g/mol. Its IUPAC name is (3S,3aR,6aR)-6-[2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3S,3aR,6aR)-6-[2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 126652403 |
| Molecular Formula | C22H22ClN3O6 |
| Molecular Weight | 459.89 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (3S,3aR,6aR)-6-[2-chloro-4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenoxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | COc1cc2ncnc(Nc3ccc(OC4CO[C@H]5[C@@H]4OC[C@@H]5O)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C22H22ClN3O6/c1-28-17-6-12-14(7-18(17)29-2)24-10-25-22(12)26-11-3-4-16(13(23)5-11)32-19-9-31-20-15(27)8-30-21(19)20/h3-7,10,15,19-21,27H,8-9H2,1-2H3,(H,24,25,26)/t15-,19?,20+,21+/m0/s1 |
| InChIKey | LMWDCCYLPLDXQG-UJOWDTLISA-N |
| XLogP | 2.95 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.89 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |