C21H17BrClF2N3O4 — CID 70946739
7-[[(3R,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 70946739) has the molecular formula C21H17BrClF2N3O4 and a molecular weight of 528.74 g/mol. Its IUPAC name is 7-[[(3R,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3R,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 70946739 |
| Molecular Formula | C21H17BrClF2N3O4 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | 7-[[(3R,6R,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(4-bromo-3-chloro-2-fluorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Br)c(Cl)c3F)ncnc2cc1O[C@@H]1CO[C@@H]2C1OC[C@H]2F |
| InChI | InChI=1S/C21H17BrClF2N3O4/c1-29-14-4-9-13(5-15(14)32-16-7-31-19-11(24)6-30-20(16)19)26-8-27-21(9)28-12-3-2-10(22)17(23)18(12)25/h2-5,8,11,16,19-20H,6-7H2,1H3,(H,26,27,28)/t11-,16-,19+,20?/m1/s1 |
| InChIKey | HQHKCYQAKIHFNI-LNVLOHDESA-N |
| XLogP | 4.82 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|