C21H19ClFN3O4 — CID 58617026
7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(3-chlorophenyl)-6-methoxyquinazolin-4-amine (PubChem CID 58617026) has the molecular formula C21H19ClFN3O4 and a molecular weight of 431.85 g/mol. Its IUPAC name is 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(3-chlorophenyl)-6-methoxyquinazolin-4-amine.
| Compound Name | 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(3-chlorophenyl)-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 58617026 |
| Molecular Formula | C21H19ClFN3O4 |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 7-[[(3aS,6aR)-6-fluoro-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-N-(3-chlorophenyl)-6-methoxyquinazolin-4-amine |
| SMILES | COc1cc2c(Nc3cccc(Cl)c3)ncnc2cc1OC1CO[C@H]2C(F)CO[C@@H]12 |
| InChI | InChI=1S/C21H19ClFN3O4/c1-27-16-6-13-15(24-10-25-21(13)26-12-4-2-3-11(22)5-12)7-17(16)30-18-9-29-19-14(23)8-28-20(18)19/h2-7,10,14,18-20H,8-9H2,1H3,(H,24,25,26)/t14?,18?,19-,20-/m0/s1 |
| InChIKey | DJXUANYGYXJJAE-FJZQGJIISA-N |
| XLogP | 3.92 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |