C29H28ClN3O6 — CID 126646672
N-[4-[[(3S,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-chlorophenyl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 126646672) has the molecular formula C29H28ClN3O6 and a molecular weight of 550.01 g/mol. Its IUPAC name is N-[4-[[(3S,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-chlorophenyl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[4-[[(3S,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-chlorophenyl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 126646672 |
| Molecular Formula | C29H28ClN3O6 |
| Molecular Weight | 550.01 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | N-[4-[[(3S,3aR,6S,6aR)-3-phenylmethoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-3-chlorophenyl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(O[C@H]4CO[C@H]5[C@@H]4OC[C@@H]5OCc4ccccc4)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C29H28ClN3O6/c1-34-23-11-19-21(12-24(23)35-2)31-16-32-29(19)33-18-8-9-22(20(30)10-18)39-26-15-38-27-25(14-37-28(26)27)36-13-17-6-4-3-5-7-17/h3-12,16,25-28H,13-15H2,1-2H3,(H,31,32,33)/t25-,26-,27+,28+/m0/s1 |
| InChIKey | SKOYFMPOAZTLSK-YVHASNINSA-N |
| XLogP | 5.17 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |