C20H17BrClN3O4 — CID 70795175
7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-(4-bromo-3-chloroanilino)quinazolin-6-ol (PubChem CID 70795175) has the molecular formula C20H17BrClN3O4 and a molecular weight of 478.73 g/mol. Its IUPAC name is 7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-(4-bromo-3-chloroanilino)quinazolin-6-ol.
| Compound Name | 7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-(4-bromo-3-chloroanilino)quinazolin-6-ol |
|---|---|
| PubChem CID | 70795175 |
| Molecular Formula | C20H17BrClN3O4 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 7-[[(6R)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-(4-bromo-3-chloroanilino)quinazolin-6-ol |
| SMILES | Oc1cc2c(Nc3ccc(Br)c(Cl)c3)ncnc2cc1O[C@@H]1COC2CCOC21 |
| InChI | InChI=1S/C20H17BrClN3O4/c21-12-2-1-10(5-13(12)22)25-20-11-6-15(26)17(7-14(11)23-9-24-20)29-18-8-28-16-3-4-27-19(16)18/h1-2,5-7,9,16,18-19,26H,3-4,8H2,(H,23,24,25)/t16?,18-,19?/m1/s1 |
| InChIKey | UKSCHBZCRBPOCH-CUYAVPTFSA-N |
| XLogP | 4.43 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |