C22H23Cl2N3O3 — CID 153068829
N-(3,4-dichlorophenyl)-6-methoxy-7-(oxepan-2-ylmethoxy)quinazolin-4-amine (PubChem CID 153068829) has the molecular formula C22H23Cl2N3O3 and a molecular weight of 448.35 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-methoxy-7-(oxepan-2-ylmethoxy)quinazolin-4-amine.
| Compound Name | N-(3,4-dichlorophenyl)-6-methoxy-7-(oxepan-2-ylmethoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 153068829 |
| Molecular Formula | C22H23Cl2N3O3 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-methoxy-7-(oxepan-2-ylmethoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cc1OCC1CCCCCO1 |
| InChI | InChI=1S/C22H23Cl2N3O3/c1-28-20-10-16-19(11-21(20)30-12-15-5-3-2-4-8-29-15)25-13-26-22(16)27-14-6-7-17(23)18(24)9-14/h6-7,9-11,13,15H,2-5,8,12H2,1H3,(H,25,26,27) |
| InChIKey | VKXVBHWGGYJKTM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |