C21H22FN3O4 — CID 118112194
4-fluoro-3-[[6-methoxy-7-(oxolan-2-ylmethoxy)quinazolin-4-yl]amino]-2-methylphenol (PubChem CID 118112194) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is 4-fluoro-3-[[6-methoxy-7-(oxolan-2-ylmethoxy)quinazolin-4-yl]amino]-2-methylphenol.
| Compound Name | 4-fluoro-3-[[6-methoxy-7-(oxolan-2-ylmethoxy)quinazolin-4-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 118112194 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-fluoro-3-[[6-methoxy-7-(oxolan-2-ylmethoxy)quinazolin-4-yl]amino]-2-methylphenol |
| SMILES | COc1cc2c(Nc3c(F)ccc(O)c3C)ncnc2cc1OCC1CCCO1 |
| InChI | InChI=1S/C21H22FN3O4/c1-12-17(26)6-5-15(22)20(12)25-21-14-8-18(27-2)19(9-16(14)23-11-24-21)29-10-13-4-3-7-28-13/h5-6,8-9,11,13,26H,3-4,7,10H2,1-2H3,(H,23,24,25) |
| InChIKey | YPSQQALJBJERNM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |