C22H27FN4O4 — CID 118111975
4-fluoro-3-[[7-[3-[2-hydroxyethyl(methyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-methylphenol (PubChem CID 118111975) has the molecular formula C22H27FN4O4 and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-fluoro-3-[[7-[3-[2-hydroxyethyl(methyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-methylphenol.
| Compound Name | 4-fluoro-3-[[7-[3-[2-hydroxyethyl(methyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 118111975 |
| Molecular Formula | C22H27FN4O4 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 4-fluoro-3-[[7-[3-[2-hydroxyethyl(methyl)amino]propoxy]-6-methoxyquinazolin-4-yl]amino]-2-methylphenol |
| SMILES | COc1cc2c(Nc3c(F)ccc(O)c3C)ncnc2cc1OCCCN(C)CCO |
| InChI | InChI=1S/C22H27FN4O4/c1-14-18(29)6-5-16(23)21(14)26-22-15-11-19(30-3)20(12-17(15)24-13-25-22)31-10-4-7-27(2)8-9-28/h5-6,11-13,28-29H,4,7-10H2,1-3H3,(H,24,25,26) |
| InChIKey | OUYRCRDXPXFMQL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|