C25H31FN4O4 — CID 118112031
4-fluoro-3-[[6-methoxy-7-[3-(4-methoxypiperidin-1-yl)propoxy]quinazolin-4-yl]amino]-2-methylphenol (PubChem CID 118112031) has the molecular formula C25H31FN4O4 and a molecular weight of 470.55 g/mol. Its IUPAC name is 4-fluoro-3-[[6-methoxy-7-[3-(4-methoxypiperidin-1-yl)propoxy]quinazolin-4-yl]amino]-2-methylphenol.
| Compound Name | 4-fluoro-3-[[6-methoxy-7-[3-(4-methoxypiperidin-1-yl)propoxy]quinazolin-4-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 118112031 |
| Molecular Formula | C25H31FN4O4 |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 4-fluoro-3-[[6-methoxy-7-[3-(4-methoxypiperidin-1-yl)propoxy]quinazolin-4-yl]amino]-2-methylphenol |
| SMILES | COc1cc2c(Nc3c(F)ccc(O)c3C)ncnc2cc1OCCCN1CCC(OC)CC1 |
| InChI | InChI=1S/C25H31FN4O4/c1-16-21(31)6-5-19(26)24(16)29-25-18-13-22(33-3)23(14-20(18)27-15-28-25)34-12-4-9-30-10-7-17(32-2)8-11-30/h5-6,13-15,17,31H,4,7-12H2,1-3H3,(H,27,28,29) |
| InChIKey | OXGYFEKBLBIRRP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|