C24H30FN5O4 — CID 118112199
4-fluoro-3-[[6-methoxy-7-[2-(2-morpholin-4-ylethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol (PubChem CID 118112199) has the molecular formula C24H30FN5O4 and a molecular weight of 471.53 g/mol. Its IUPAC name is 4-fluoro-3-[[6-methoxy-7-[2-(2-morpholin-4-ylethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol.
| Compound Name | 4-fluoro-3-[[6-methoxy-7-[2-(2-morpholin-4-ylethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol |
|---|---|
| PubChem CID | 118112199 |
| Molecular Formula | C24H30FN5O4 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-fluoro-3-[[6-methoxy-7-[2-(2-morpholin-4-ylethylamino)ethoxy]quinazolin-4-yl]amino]-2-methylphenol |
| SMILES | COc1cc2c(Nc3c(F)ccc(O)c3C)ncnc2cc1OCCNCCN1CCOCC1 |
| InChI | InChI=1S/C24H30FN5O4/c1-16-20(31)4-3-18(25)23(16)29-24-17-13-21(32-2)22(14-19(17)27-15-28-24)34-10-6-26-5-7-30-8-11-33-12-9-30/h3-4,13-15,26,31H,5-12H2,1-2H3,(H,27,28,29) |
| InChIKey | KJANLOTWHSINNY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 101.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|